Difference between revisions of "PWY-6372"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14916 CPD-14916] == * common-name: ** (r)-3-hydroxyoctanoyl-coa * smiles: ** cccccc(cc(sccn...")
 
(Created page with "Category:pathway == Pathway PWY-6372 == * taxonomic-range: ** tax-33083 * common-name: ** 1d-myo-inositol hexakisphosphate biosynthesis iv (dictyostelium) == Reaction(s) f...")
 
(9 intermediate revisions by 4 users not shown)
Line 1: Line 1:
[[Category:metabolite]]
+
[[Category:pathway]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14916 CPD-14916] ==
+
== Pathway PWY-6372 ==
 +
* taxonomic-range:
 +
** tax-33083
 
* common-name:
 
* common-name:
** (r)-3-hydroxyoctanoyl-coa
+
** 1d-myo-inositol hexakisphosphate biosynthesis iv (dictyostelium)
* smiles:
+
== Reaction(s) found ==
** cccccc(cc(sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-])=o)o
+
* [[2.7.1.140-RXN]]
* inchi-key:
+
* [[MYO-INOSITOL-1-PHOSPHATE-SYNTHASE-RXN]]
** atvgtmkwkducms-jwbywsjjsa-j
+
* [[RXN-7163]]
* molecular-weight:
+
== Reaction(s) not found ==
** 905.7
+
* [NoneMYO-INOSITOL-1-KINASE-RXN MYO-INOSITOL-1-KINASE-RXN]
== Reaction(s) known to consume the compound ==
+
* [NoneRXN-10984 RXN-10984]
* [[RXN-13279-CPD-14916/NADP//CPD0-2106/NADPH/PROTON.39.]]
+
* [NoneRXN-10982 RXN-10982]
* [[RXN-14275]]
+
* [NoneRXN-10983 RXN-10983]
== Reaction(s) known to produce the compound ==
+
{{#set: taxonomic-range=tax-33083}}
* [[RXN-13279-CPD-14916/NADP//CPD0-2106/NADPH/PROTON.39.]]
+
{{#set: common-name=1d-myo-inositol hexakisphosphate biosynthesis iv (dictyostelium)}}
* [[RXN-14276]]
+
{{#set: nb reaction found=3}}
== Reaction(s) of unknown directionality ==
+
{{#set: completion rate=0.43}}
{{#set: common-name=(r)-3-hydroxyoctanoyl-coa}}
+
{{#set: nb total reaction=7}}
{{#set: inchi-key=inchikey=atvgtmkwkducms-jwbywsjjsa-j}}
 
{{#set: molecular-weight=905.7}}
 

Latest revision as of 10:57, 18 March 2021

Pathway PWY-6372

  • taxonomic-range:
    • tax-33083
  • common-name:
    • 1d-myo-inositol hexakisphosphate biosynthesis iv (dictyostelium)

Reaction(s) found

Reaction(s) not found

  • [NoneMYO-INOSITOL-1-KINASE-RXN MYO-INOSITOL-1-KINASE-RXN]
  • [NoneRXN-10984 RXN-10984]
  • [NoneRXN-10982 RXN-10982]
  • [NoneRXN-10983 RXN-10983]