Difference between revisions of "PWY-6383"

Latest revision as of 10:58, 18 March 2021

@@ Line 1: / Line 1: @@
-[[Category:metabolite]]
+[[Category:pathway]]
-== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=FMN FMN] ==
+== Pathway PWY-6383 ==
+* taxonomic-range:
+** tax-1762
 * common-name:
-** fmn
+** mono-trans, poly-cis decaprenyl phosphate biosynthesis
-* smiles:
+== Reaction(s) found ==
-** cc2(=cc1(n=c3(c(=o)[n-]c(=o)n=c(n(cc(o)c(o)c(o)cop([o-])(=o)[o-])c=1c=c(c)2)3)))
+* [[GPPSYN-RXN]]
-* inchi-key:
+* [[IPPISOM-RXN]]
-** ankzybdxhmzbdk-scrdcrapsa-k
+== Reaction(s) not found ==
-* molecular-weight:
+* [NoneRXN-11023 RXN-11023]
-** 453.324
+* [NoneRXN-11027 RXN-11027]
-== Reaction(s) known to consume the compound ==
+* [None2.5.1.68-RXN 2.5.1.68-RXN]
-* [[FAD-PYROPHOSPHATASE-RXN]]
+{{#set: taxonomic-range=tax-1762}}
-* [[FADSYN-RXN]]
+{{#set: common-name=mono-trans, poly-cis decaprenyl phosphate biosynthesis}}
-* [[RXN-9510]]
+{{#set: nb reaction found=2}}
-* [[RXN0-5187]]
+{{#set: completion rate=0.4}}
-== Reaction(s) known to produce the compound ==
+{{#set: nb total reaction=5}}
-* [[ARPT]]
-* [[FAD-PYROPHOSPHATASE-RXN]]
-* [[RIBOFLAVINKIN-RXN]]
-* [[RXN-9510]]
-== Reaction(s) of unknown directionality ==
-{{#set: common-name=fmn}}
-{{#set: inchi-key=inchikey=ankzybdxhmzbdk-scrdcrapsa-k}}
-{{#set: molecular-weight=453.324}}