Difference between revisions of "PWY-6386"

Revision as of 20:17, 18 December 2020

@@ Line 1: / Line 1: @@
-[[Category:metabolite]]
+[[Category:pathway]]
-== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14873 CPD-14873] ==
+== Pathway PWY-7111 ==
+* taxonomic-range:
+** tax-2157
+** tax-2759
+** tax-2
 * common-name:
-** 3-amino-4-hydroxybenzoate
+** pyruvate fermentation to isobutanol (engineered)
-* smiles:
+== Reaction(s) found ==
-** c(=o)([o-])c1(c=c(n)c(o)=cc=1)
+* [[ACETOLACTREDUCTOISOM-RXN]]
-* inchi-key:
+* [[ACETOLACTSYN-RXN]]
-** mrbkrzapgucwos-uhfffaoysa-m
+* [[DIHYDROXYISOVALDEHYDRAT-RXN]]
-* molecular-weight:
+* [[RXN-7657]]
-** 152.129
+== Reaction(s) not found ==
-== Reaction(s) known to consume the compound ==
+* [NoneRXN-7643 RXN-7643]
-* [[RXN-15414]]
+{{#set: taxonomic-range=tax-2|tax-2157|tax-2759}}
-== Reaction(s) known to produce the compound ==
+{{#set: common-name=pyruvate fermentation to isobutanol (engineered)}}
-== Reaction(s) of unknown directionality ==
+{{#set: nb reaction found=4}}
-{{#set: common-name=3-amino-4-hydroxybenzoate}}
+{{#set: completion rate=0.8}}
-{{#set: inchi-key=inchikey=mrbkrzapgucwos-uhfffaoysa-m}}
+{{#set: nb total reaction=5}}
-{{#set: molecular-weight=152.129}}