Difference between revisions of "PWY-6399"

Latest revision as of 10:58, 18 March 2021

@@ Line 1: / Line 1: @@
-[[Category:metabolite]]
+[[Category:pathway]]
-== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11404 CPD-11404] ==
+== Pathway PWY-6399 ==
+* taxonomic-range:
+** tax-7742
 * common-name:
-** 3,3',5-triiodothyroacetate
+** melatonin degradation ii
-* smiles:
+== Reaction(s) found ==
-** c(=o)([o-])cc1(c=c(i)c(=c(i)c=1)oc2(=cc(i)=c(o)c=c2))
+* [[RXN-11067]]
-* inchi-key:
+== Reaction(s) not found ==
-** uowzuvnaguaeqc-uhfffaoysa-m
+* [NoneRXN-11066 RXN-11066]
-* molecular-weight:
+* [NoneRXN-11069 RXN-11069]
-** 620.928
+* [NoneRXN-11068 RXN-11068]
-== Reaction(s) known to consume the compound ==
+{{#set: taxonomic-range=tax-7742}}
-* [[RXN-10618]]
+{{#set: common-name=melatonin degradation ii}}
-* [[RXN-10619]]
+{{#set: nb reaction found=1}}
-== Reaction(s) known to produce the compound ==
+{{#set: completion rate=0.25}}
-== Reaction(s) of unknown directionality ==
+{{#set: nb total reaction=4}}
-{{#set: common-name=3,3',5-triiodothyroacetate}}
-{{#set: inchi-key=inchikey=uowzuvnaguaeqc-uhfffaoysa-m}}
-{{#set: molecular-weight=620.928}}