Difference between revisions of "PWY-6399"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-4822 CPD-4822] == * common-name: ** kanamycin b * smiles: ** c([n+])c1(c(o)c(o)c([n+])c(o1)...")
 
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-10353 CPD-10353] == * common-name: ** (r)-acetoin * smiles: ** cc(o)c(=o)c * inchi-key: **...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-4822 CPD-4822] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-10353 CPD-10353] ==
 
* common-name:
 
* common-name:
** kanamycin b
+
** (r)-acetoin
 
* smiles:
 
* smiles:
** c([n+])c1(c(o)c(o)c([n+])c(o1)oc2(c([n+])cc(c(c2o)oc3(oc(co)c(o)c([n+])c(o)3))[n+]))
+
** cc(o)c(=o)c
 
* inchi-key:
 
* inchi-key:
** skklouvuunmcje-fqsmhnglsa-s
+
** rowkjavdogwpat-gsvougtgsa-n
 
* molecular-weight:
 
* molecular-weight:
** 488.557
+
** 88.106
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-14553]]
+
* [[RR-BUTANEDIOL-DEHYDROGENASE-RXN]]
* [[RXN-15287]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[RR-BUTANEDIOL-DEHYDROGENASE-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=kanamycin b}}
+
{{#set: common-name=(r)-acetoin}}
{{#set: inchi-key=inchikey=skklouvuunmcje-fqsmhnglsa-s}}
+
{{#set: inchi-key=inchikey=rowkjavdogwpat-gsvougtgsa-n}}
{{#set: molecular-weight=488.557}}
+
{{#set: molecular-weight=88.106}}

Revision as of 14:18, 26 August 2019

Metabolite CPD-10353

  • common-name:
    • (r)-acetoin
  • smiles:
    • cc(o)c(=o)c
  • inchi-key:
    • rowkjavdogwpat-gsvougtgsa-n
  • molecular-weight:
    • 88.106

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality