Difference between revisions of "PWY-6415"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=P-COUMAROYL-COA P-COUMAROYL-COA] == * common-name: ** 4-coumaroyl-coa * smiles: ** cc(c)(c(o)c(...")
 
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-506 CPD-506] == * common-name: ** d-myo-inositol (1,3,4,5)-tetrakisphosphate * smiles: ** c...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=P-COUMAROYL-COA P-COUMAROYL-COA] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-506 CPD-506] ==
 
* common-name:
 
* common-name:
** 4-coumaroyl-coa
+
** d-myo-inositol (1,3,4,5)-tetrakisphosphate
 
* smiles:
 
* smiles:
** cc(c)(c(o)c(=o)nccc(=o)nccsc(=o)c=cc1(c=cc(o)=cc=1))cop(=o)(op(=o)(occ2(c(op([o-])(=o)[o-])c(o)c(o2)n4(c3(=c(c(n)=nc=n3)n=c4))))[o-])[o-]
+
** c1(o)(c(op([o-])(=o)[o-])c(op(=o)([o-])[o-])c(op(=o)([o-])[o-])c(o)c(op([o-])([o-])=o)1)
 
* inchi-key:
 
* inchi-key:
** dmzokbalnzwdki-matmfaihsa-j
+
** cipfcgzlfxvxbg-cnwjwelysa-f
 
* molecular-weight:
 
* molecular-weight:
** 909.648
+
** 492.013
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[NARINGENIN-CHALCONE-SYNTHASE-RXN]]
+
* [[RXN-7184]]
* [[RXN-1101]]
+
* [[RXN-8730]]
* [[RXN-11244]]
 
* [[RXN-3142]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[4-COUMARATE--COA-LIGASE-RXN]]
+
* [[2.7.1.127-RXN]]
 +
* [[2.7.1.139-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=4-coumaroyl-coa}}
+
{{#set: common-name=d-myo-inositol (1,3,4,5)-tetrakisphosphate}}
{{#set: inchi-key=inchikey=dmzokbalnzwdki-matmfaihsa-j}}
+
{{#set: inchi-key=inchikey=cipfcgzlfxvxbg-cnwjwelysa-f}}
{{#set: molecular-weight=909.648}}
+
{{#set: molecular-weight=492.013}}

Revision as of 14:18, 26 August 2019

Metabolite CPD-506

  • common-name:
    • d-myo-inositol (1,3,4,5)-tetrakisphosphate
  • smiles:
    • c1(o)(c(op([o-])(=o)[o-])c(op(=o)([o-])[o-])c(op(=o)([o-])[o-])c(o)c(op([o-])([o-])=o)1)
  • inchi-key:
    • cipfcgzlfxvxbg-cnwjwelysa-f
  • molecular-weight:
    • 492.013

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality