Difference between revisions of "PWY-6433"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14159 CPD-14159] == * common-name: ** 6''-o-carbamoylkanamycin b * smiles: ** c([n+])c1(c(o...")
(Created page with "Category:pathway == Pathway PWY-6433 == * taxonomic-range: ** tax-33090 * common-name: ** hydroxylated fatty acid biosynthesis (plants) == Reaction(s) found == * RXN-133...")
 
(8 intermediate revisions by 3 users not shown)
Line 1: Line 1:
−
[[Category:metabolite]]
+
[[Category:pathway]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14159 CPD-14159] ==
+
== Pathway PWY-6433 ==
 +
* taxonomic-range:
 +
** tax-33090
 
* common-name:
 
* common-name:
−
** 6''-o-carbamoylkanamycin b
+
** hydroxylated fatty acid biosynthesis (plants)
−
* smiles:
+
== Reaction(s) found ==
−
** c([n+])c1(c(o)c(o)c([n+])c(o1)oc2(c([n+])cc(c(c2o)oc3(oc(coc(=o)n)c(o)c([n+])c(o)3))[n+]))
+
* [[RXN-13322]]
−
* inchi-key:
+
* [[RXN-14484]]
−
** xcstznjiqfivpe-fqsmhnglsa-s
+
* [[RXN-14485]]
−
* molecular-weight:
+
* [[RXN-14491]]
−
** 531.582
+
* [[RXN-14492]]
−
== Reaction(s) known to consume the compound ==
+
* [[RXN-14493]]
−
== Reaction(s) known to produce the compound ==
+
* [[RXN-14494]]
−
* [[RXN-14553]]
+
* [[RXN-16149]]
−
* [[RXN-15287]]
+
* [[RXN-16150]]
−
== Reaction(s) of unknown directionality ==
+
* [[RXN-16151]]
−
{{#set: common-name=6''-o-carbamoylkanamycin b}}
+
* [[RXN-16152]]
−
{{#set: inchi-key=inchikey=xcstznjiqfivpe-fqsmhnglsa-s}}
+
* [[RXN-16153]]
−
{{#set: molecular-weight=531.582}}
+
* [[RXN-16154]]
 +
* [[RXN-16155]]
 +
* [[RXN-16157]]
 +
* [[RXN-16158]]
 +
* [[RXN-9670]]
 +
== Reaction(s) not found ==
 +
* [NoneRXN-14486 RXN-14486]
 +
* [NoneRXN-14488 RXN-14488]
 +
* [NoneRXN-16156 RXN-16156]
 +
* [NoneRXN-14495 RXN-14495]
 +
* [NoneRXN-16148 RXN-16148]
 +
{{#set: taxonomic-range=tax-33090}}
 +
{{#set: common-name=hydroxylated fatty acid biosynthesis (plants)}}
 +
{{#set: nb reaction found=17}}
 +
{{#set: completion rate=0.77}}
 +
{{#set: nb total reaction=22}}

Latest revision as of 10:58, 18 March 2021

Pathway PWY-6433

  • taxonomic-range:
    • tax-33090
  • common-name:
    • hydroxylated fatty acid biosynthesis (plants)

Reaction(s) found

Reaction(s) not found

  • [NoneRXN-14486 RXN-14486]
  • [NoneRXN-14488 RXN-14488]
  • [NoneRXN-16156 RXN-16156]
  • [NoneRXN-14495 RXN-14495]
  • [NoneRXN-16148 RXN-16148]



Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=PWY-6433&oldid=130641"