Difference between revisions of "PWY-6433"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8607 CPD-8607] == * common-name: ** 4,4-dimethyl-14α-hydroxymethyl-5α-cholesta-...")
 
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14159 CPD-14159] == * common-name: ** 6''-o-carbamoylkanamycin b * smiles: ** c([n+])c1(c(o...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8607 CPD-8607] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14159 CPD-14159] ==
 
* common-name:
 
* common-name:
** 4,4-dimethyl-14α-hydroxymethyl-5α-cholesta-8-en-3β-ol
+
** 6''-o-carbamoylkanamycin b
 
* smiles:
 
* smiles:
** cc(c)cccc([ch]4(c1(c)(c(co)(c2(=c(cc1)c3(c)([ch](cc2)c(c)(c)c(o)cc3)))cc4)))c
+
** c([n+])c1(c(o)c(o)c([n+])c(o1)oc2(c([n+])cc(c(c2o)oc3(oc(coc(=o)n)c(o)c([n+])c(o)3))[n+]))
 
* inchi-key:
 
* inchi-key:
** sjpdnxkpbqhpmz-puxrvuthsa-n
+
** xcstznjiqfivpe-fqsmhnglsa-s
 
* molecular-weight:
 
* molecular-weight:
** 444.74
+
** 531.582
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN66-12]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN66-11]]
+
* [[RXN-14553]]
 +
* [[RXN-15287]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=4,4-dimethyl-14α-hydroxymethyl-5α-cholesta-8-en-3β-ol}}
+
{{#set: common-name=6''-o-carbamoylkanamycin b}}
{{#set: inchi-key=inchikey=sjpdnxkpbqhpmz-puxrvuthsa-n}}
+
{{#set: inchi-key=inchikey=xcstznjiqfivpe-fqsmhnglsa-s}}
{{#set: molecular-weight=444.74}}
+
{{#set: molecular-weight=531.582}}

Revision as of 14:18, 26 August 2019

Metabolite CPD-14159

  • common-name:
    • 6-o-carbamoylkanamycin b
  • smiles:
    • c([n+])c1(c(o)c(o)c([n+])c(o1)oc2(c([n+])cc(c(c2o)oc3(oc(coc(=o)n)c(o)c([n+])c(o)3))[n+]))
  • inchi-key:
    • xcstznjiqfivpe-fqsmhnglsa-s
  • molecular-weight:
    • 531.582

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality