Difference between revisions of "PWY-6433"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14159 CPD-14159] == * common-name: ** 6''-o-carbamoylkanamycin b * smiles: ** c([n+])c1(c(o...")
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-4187 CPD-4187] == * common-name: ** 7-dehydrocholesterol * smiles: ** cc(c)cccc(c)[ch]1(cc[...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14159 CPD-14159] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-4187 CPD-4187] ==
 
* common-name:
 
* common-name:
** 6''-o-carbamoylkanamycin b
+
** 7-dehydrocholesterol
 
* smiles:
 
* smiles:
** c([n+])c1(c(o)c(o)c([n+])c(o1)oc2(c([n+])cc(c(c2o)oc3(oc(coc(=o)n)c(o)c([n+])c(o)3))[n+]))
+
** cc(c)cccc(c)[ch]1(cc[ch]2(c(c)1cc[ch]3(c2=cc=c4(c(c)3ccc(o)c4))))
 
* inchi-key:
 
* inchi-key:
** xcstznjiqfivpe-fqsmhnglsa-s
+
** uctlrswjyqtbfz-ddpqnldtsa-n
 
* molecular-weight:
 
* molecular-weight:
** 531.582
+
** 384.644
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[RXN66-323]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-14553]]
+
* [[1.14.21.6-RXN]]
* [[RXN-15287]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=6''-o-carbamoylkanamycin b}}
+
{{#set: common-name=7-dehydrocholesterol}}
{{#set: inchi-key=inchikey=xcstznjiqfivpe-fqsmhnglsa-s}}
+
{{#set: inchi-key=inchikey=uctlrswjyqtbfz-ddpqnldtsa-n}}
{{#set: molecular-weight=531.582}}
+
{{#set: molecular-weight=384.644}}

Revision as of 09:22, 27 August 2019

Metabolite CPD-4187

  • common-name:
    • 7-dehydrocholesterol
  • smiles:
    • cc(c)cccc(c)[ch]1(cc[ch]2(c(c)1cc[ch]3(c2=cc=c4(c(c)3ccc(o)c4))))
  • inchi-key:
    • uctlrswjyqtbfz-ddpqnldtsa-n
  • molecular-weight:
    • 384.644

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality