Difference between revisions of "PWY-6443"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-3041 CPD-3041] == * common-name: ** isoliquiritigenin * smiles: ** c2(c=c(o)c=cc(c=cc(=o)c1...") |
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13518 CPD-13518] == * common-name: ** nω-hydroxy-l-arginine * smiles: ** c(nc(no)=[n+...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD- | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13518 CPD-13518] == |
* common-name: | * common-name: | ||
| − | ** | + | ** nω-hydroxy-l-arginine |
* smiles: | * smiles: | ||
| − | ** | + | ** c(nc(no)=[n+])ccc([n+])c([o-])=o |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** fqwravymzulpnk-bypyzucnsa-o |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 191.209 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[RXN- | + | * [[RXN-13565]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[RXN- | + | * [[RXN-13564]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=nω-hydroxy-l-arginine}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=fqwravymzulpnk-bypyzucnsa-o}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=191.209}} |
Revision as of 09:22, 27 August 2019
Contents
Metabolite CPD-13518
- common-name:
- nω-hydroxy-l-arginine
- smiles:
- c(nc(no)=[n+])ccc([n+])c([o-])=o
- inchi-key:
- fqwravymzulpnk-bypyzucnsa-o
- molecular-weight:
- 191.209
