Difference between revisions of "PWY-6453"

Revision as of 20:16, 18 December 2020

@@ Line 1: / Line 1: @@
-[[Category:metabolite]]
+[[Category:pathway]]
-== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12658 CPD-12658] ==
+== Pathway PWY-6829 ==
+* taxonomic-range:
+** tax-2759
 * common-name:
-** riboflavin cyclic-4',5'-phosphate
+** trna methylation (yeast)
-* smiles:
+== Reaction(s) found ==
-** cc3(c=c2(n=c4(c(=o)n=c(o)n=c(n(cc(o)c(o)c1(cop([o-])(=o)o1))c2=cc(c)=3)4)))
+* [[RXN-11856]]
-* inchi-key:
+* [[RXN-11868]]
-** cvzkydyrjqyydj-mbnywofbsa-m
+* [[RXN-12374]]
-* molecular-weight:
+* [[RXN-12375]]
-** 437.325
+* [[RXN-12376]]
-== Reaction(s) known to consume the compound ==
+* [[RXN-12461]]
-* [[RXN-11695]]
+* [[RXN-12466]]
-== Reaction(s) known to produce the compound ==
+* [[RXN-12477]]
-* [[RXN-11695]]
+* [[RXN-12478]]
-== Reaction(s) of unknown directionality ==
+* [[RXN-12479]]
-{{#set: common-name=riboflavin cyclic-4',5'-phosphate}}
+* [[RXN-14517]]
-{{#set: inchi-key=inchikey=cvzkydyrjqyydj-mbnywofbsa-m}}
+== Reaction(s) not found ==
-{{#set: molecular-weight=437.325}}
+* [NoneRXN-12368 RXN-12368]
+* [NoneRXN-11857 RXN-11857]
+* [NoneRXN-11858 RXN-11858]
+* [NoneRXN-11859 RXN-11859]
+{{#set: taxonomic-range=tax-2759}}
+{{#set: common-name=trna methylation (yeast)}}
+{{#set: nb reaction found=11}}
+{{#set: completion rate=0.73}}
+{{#set: nb total reaction=15}}