Difference between revisions of "PWY-6457"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=D-ALA-D-ALA D-ALA-D-ALA] == * common-name: ** d-alanyl-d-alanine * smiles: ** cc([n+])c(=o)nc(c...")
 
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CU+2 CU+2] == * common-name: ** cu2+ * smiles: ** [cu++] * inchi-key: ** jpvynhnxodakfh-uhfffao...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=D-ALA-D-ALA D-ALA-D-ALA] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CU+2 CU+2] ==
 
* common-name:
 
* common-name:
** d-alanyl-d-alanine
+
** cu2+
 
* smiles:
 
* smiles:
** cc([n+])c(=o)nc(c)c([o-])=o
+
** [cu++]
 
* inchi-key:
 
* inchi-key:
** defjqiddeaulhb-qwwzwvqmsa-n
+
** jpvynhnxodakfh-uhfffaoysa-n
 
* molecular-weight:
 
* molecular-weight:
** 160.172
+
** 63.546
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[3.6.3.4-RXN]]
 +
* [[Cut1]]
 +
* [[ExchangeSeed-CU+2]]
 +
* [[TransportSeed-CU+2]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[DALADALALIG-RXN]]
+
* [[3.6.3.4-RXN]]
 +
* [[Cut1]]
 +
* [[ExchangeSeed-CU+2]]
 +
* [[TransportSeed-CU+2]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=d-alanyl-d-alanine}}
+
{{#set: common-name=cu2+}}
{{#set: inchi-key=inchikey=defjqiddeaulhb-qwwzwvqmsa-n}}
+
{{#set: inchi-key=inchikey=jpvynhnxodakfh-uhfffaoysa-n}}
{{#set: molecular-weight=160.172}}
+
{{#set: molecular-weight=63.546}}

Revision as of 14:18, 26 August 2019

Metabolite CU+2

  • common-name:
    • cu2+
  • smiles:
    • [cu++]
  • inchi-key:
    • jpvynhnxodakfh-uhfffaoysa-n
  • molecular-weight:
    • 63.546

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality