Difference between revisions of "PWY-6458"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12019 CPD-12019] == * common-name: ** 5-methoxyindoleacetaldehyde * smiles: ** coc2(c=cc1(=...")
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-320 CPD-320] == * common-name: ** ethylnitronate * smiles: ** cc=n(=o)[o-] * inchi-key: **...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12019 CPD-12019] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-320 CPD-320] ==
 
* common-name:
 
* common-name:
** 5-methoxyindoleacetaldehyde
+
** ethylnitronate
 
* smiles:
 
* smiles:
** coc2(c=cc1(=c(c(cc=o)=cn1)c=2))
+
** cc=n(=o)[o-]
 
* inchi-key:
 
* inchi-key:
** xvhhcgdxcdkklh-uhfffaoysa-n
+
** yerbbvnyiklxdm-uhfffaoysa-n
 
* molecular-weight:
 
* molecular-weight:
** 189.213
+
** 74.059
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[2-NITROPROPANE-DIOXYGENASE-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-11067]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=5-methoxyindoleacetaldehyde}}
+
{{#set: common-name=ethylnitronate}}
{{#set: inchi-key=inchikey=xvhhcgdxcdkklh-uhfffaoysa-n}}
+
{{#set: inchi-key=inchikey=yerbbvnyiklxdm-uhfffaoysa-n}}
{{#set: molecular-weight=189.213}}
+
{{#set: molecular-weight=74.059}}

Revision as of 09:22, 27 August 2019

Metabolite CPD-320

  • common-name:
    • ethylnitronate
  • smiles:
    • cc=n(=o)[o-]
  • inchi-key:
    • yerbbvnyiklxdm-uhfffaoysa-n
  • molecular-weight:
    • 74.059

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality