Difference between revisions of "PWY-6470"

Latest revision as of 10:59, 18 March 2021

@@ Line 1: / Line 1: @@
-[[Category:metabolite]]
+[[Category:pathway]]
-== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=QUINOLINATE QUINOLINATE] ==
+== Pathway PWY-6470 ==
+* taxonomic-range:
+** tax-201174
+** tax-1239
 * common-name:
-** quinolinate
+** peptidoglycan biosynthesis v (&beta;-lactam resistance)
-* smiles:
+== Reaction(s) found ==
-** c1(=cc=c(c(c([o-])=o)=n1)c([o-])=o)
+* [[RXN-11347]]
-* inchi-key:
+== Reaction(s) not found ==
-** gjawhxhkyyxbsv-uhfffaoysa-l
+* [NoneRXN-11344 RXN-11344]
-* molecular-weight:
+* [NoneRXN-11348 RXN-11348]
-** 165.105
+* [NoneRXN-11349 RXN-11349]
-== Reaction(s) known to consume the compound ==
+* [NoneRXN-11343 RXN-11343]
-* [[QUINOPRIBOTRANS-RXN]]
+* [NoneRXN-15521 RXN-15521]
-== Reaction(s) known to produce the compound ==
+* [None3.4.17.14-RXN 3.4.17.14-RXN]
-* [[QUINOLINATE-SYNTHA-RXN]]
+* [NoneRXN-11345 RXN-11345]
-* [[QUINOLINATE-SYNTHE-MULTI-RXN]]
+* [NoneRXN-11346 RXN-11346]
-== Reaction(s) of unknown directionality ==
+{{#set: taxonomic-range=tax-1239|tax-201174}}
-{{#set: common-name=quinolinate}}
+{{#set: common-name=peptidoglycan biosynthesis v (&beta;-lactam resistance)}}
-{{#set: inchi-key=inchikey=gjawhxhkyyxbsv-uhfffaoysa-l}}
+{{#set: nb reaction found=1}}
-{{#set: molecular-weight=165.105}}
+{{#set: completion rate=0.11}}
+{{#set: nb total reaction=9}}