Difference between revisions of "PWY-6470"

Latest revision as of 10:59, 18 March 2021

@@ Line 1: / Line 1: @@
-[[Category:metabolite]]
+[[Category:pathway]]
-== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DIHYDROXYPHENYLGLYCOLALDEHYDE DIHYDROXYPHENYLGLYCOLALDEHYDE] ==
+== Pathway PWY-6470 ==
+* taxonomic-range:
+** tax-201174
+** tax-1239
 * common-name:
-** 3,4-dihydroxyphenylglycolaldehyde
+** peptidoglycan biosynthesis v (&beta;-lactam resistance)
-* smiles:
+== Reaction(s) found ==
-** c(=o)c(o)c1(c=cc(o)=c(o)c=1)
+* [[RXN-11347]]
-* inchi-key:
+== Reaction(s) not found ==
-** yugmcljiwgekck-qmmmgpobsa-n
+* [NoneRXN-11344 RXN-11344]
-* molecular-weight:
+* [NoneRXN-11348 RXN-11348]
-** 168.149
+* [NoneRXN-11349 RXN-11349]
-== Reaction(s) known to consume the compound ==
+* [NoneRXN-11343 RXN-11343]
-* [[RXN-10911]]
+* [NoneRXN-15521 RXN-15521]
-* [[RXN-10912]]
+* [None3.4.17.14-RXN 3.4.17.14-RXN]
-== Reaction(s) known to produce the compound ==
+* [NoneRXN-11345 RXN-11345]
-* [[RXN-10907]]
+* [NoneRXN-11346 RXN-11346]
-* [[RXN-10908]]
+{{#set: taxonomic-range=tax-1239|tax-201174}}
-== Reaction(s) of unknown directionality ==
+{{#set: common-name=peptidoglycan biosynthesis v (&beta;-lactam resistance)}}
-{{#set: common-name=3,4-dihydroxyphenylglycolaldehyde}}
+{{#set: nb reaction found=1}}
-{{#set: inchi-key=inchikey=yugmcljiwgekck-qmmmgpobsa-n}}
+{{#set: completion rate=0.11}}
-{{#set: molecular-weight=168.149}}
+{{#set: nb total reaction=9}}