Difference between revisions of "PWY-6473"

Latest revision as of 11:00, 18 March 2021

@@ Line 1: / Line 1: @@
-[[Category:metabolite]]
+[[Category:pathway]]
-== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-10277 CPD-10277] ==
+== Pathway PWY-6473 ==
+* taxonomic-range:
+** tax-33090
 * common-name:
-** lotaustralin
+** 4-aminobutanoate degradation iv
-* smiles:
+== Reaction(s) found ==
-** ccc(oc1(oc(co)c(o)c(o)c(o)1))(c#n)c
+* [[SUCCINATE-SEMIALDEHYDE-DEHYDROGENASE-RXN]]
-* inchi-key:
+== Reaction(s) not found ==
-** wewbwvmtoyuphh-qhaqebjbsa-n
+* [NoneRXN-6902 RXN-6902]
-* molecular-weight:
+{{#set: taxonomic-range=tax-33090}}
-** 261.274
+{{#set: common-name=4-aminobutanoate degradation iv}}
-== Reaction(s) known to consume the compound ==
+{{#set: nb reaction found=1}}
-* [[RXN-9674]]
+{{#set: completion rate=0.5}}
-== Reaction(s) known to produce the compound ==
+{{#set: nb total reaction=2}}
-* [[RXN-13603]]
-== Reaction(s) of unknown directionality ==
-{{#set: common-name=lotaustralin}}
-{{#set: inchi-key=inchikey=wewbwvmtoyuphh-qhaqebjbsa-n}}
-{{#set: molecular-weight=261.274}}