Difference between revisions of "PWY-6481"

Latest revision as of 10:58, 18 March 2021

@@ Line 1: / Line 1: @@
-[[Category:metabolite]]
+[[Category:pathway]]
-== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17858 CPD-17858] ==
+== Pathway PWY-6481 ==
+* taxonomic-range:
+** tax-2
+** tax-2759
 * common-name:
-** &omega;-saturated c55 dolichol phosphate
+** l-dopa and l-dopachrome biosynthesis
-* smiles:
+== Reaction(s) found ==
-** cc(c)cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(ccop(=o)([o-])[o-])c
+* [[MONOPHENOL-MONOOXYGENASE-RXN]]
-* inchi-key:
+== Reaction(s) not found ==
-** ktgsdhzxakcyhm-lstwdcehsa-l
+* [NoneRXN-11369 RXN-11369]
-* molecular-weight:
+* [NoneRXN-8483 RXN-8483]
-** 849.311
+{{#set: taxonomic-range=tax-2|tax-2759}}
-== Reaction(s) known to consume the compound ==
+{{#set: common-name=l-dopa and l-dopachrome biosynthesis}}
-* [[RXN-16602]]
+{{#set: nb reaction found=1}}
-== Reaction(s) known to produce the compound ==
+{{#set: completion rate=0.33}}
-== Reaction(s) of unknown directionality ==
+{{#set: nb total reaction=3}}
-{{#set: common-name=&omega;-saturated c55 dolichol phosphate}}
-{{#set: inchi-key=inchikey=ktgsdhzxakcyhm-lstwdcehsa-l}}
-{{#set: molecular-weight=849.311}}