Difference between revisions of "PWY-6481"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17858 CPD-17858] == * common-name: ** ω-saturated c55 dolichol phosphate * smiles: **...") |
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=L-GAMMA-GLUTAMYLCYSTEINE L-GAMMA-GLUTAMYLCYSTEINE] == * common-name: ** γ-l-glutamyl-l-cy...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=L-GAMMA-GLUTAMYLCYSTEINE L-GAMMA-GLUTAMYLCYSTEINE] == |
* common-name: | * common-name: | ||
| − | ** & | + | ** γ-l-glutamyl-l-cysteine |
* smiles: | * smiles: | ||
| − | ** | + | ** c(s)c(c([o-])=o)nc(=o)ccc([n+])c([o-])=o |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** ritkhvbhsgluln-whfbiakzsa-m |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 249.261 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[RXN- | + | * [[GLUTATHIONE-SYN-RXN]] |
| + | * [[RXN-14430]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| + | * [[GLUTCYSLIG-RXN]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name=& | + | {{#set: common-name=γ-l-glutamyl-l-cysteine}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=ritkhvbhsgluln-whfbiakzsa-m}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=249.261}} |
Revision as of 09:22, 27 August 2019
Contents
Metabolite L-GAMMA-GLUTAMYLCYSTEINE
- common-name:
- γ-l-glutamyl-l-cysteine
- smiles:
- c(s)c(c([o-])=o)nc(=o)ccc([n+])c([o-])=o
- inchi-key:
- ritkhvbhsgluln-whfbiakzsa-m
- molecular-weight:
- 249.261
