Difference between revisions of "PWY-6481"

Revision as of 20:16, 18 December 2020

@@ Line 1: / Line 1: @@
-[[Category:metabolite]]
+[[Category:pathway]]
-== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=L-GAMMA-GLUTAMYLCYSTEINE L-GAMMA-GLUTAMYLCYSTEINE] ==
+== Pathway PWY-5855 ==
+* taxonomic-range:
+** tax-2
 * common-name:
-** &gamma;-l-glutamyl-l-cysteine
+** ubiquinol-7 biosynthesis (prokaryotic)
-* smiles:
+== Reaction(s) found ==
-** c(s)c(c([o-])=o)nc(=o)ccc([n+])c([o-])=o
+* [[RXN-9225]]
-* inchi-key:
+* [[RXN-9227]]
-** ritkhvbhsgluln-whfbiakzsa-m
+* [[RXN-9229]]
-* molecular-weight:
+== Reaction(s) not found ==
-** 249.261
+* [NoneRXN-9224 RXN-9224]
-== Reaction(s) known to consume the compound ==
+* [NoneRXN-9226 RXN-9226]
-* [[GLUTATHIONE-SYN-RXN]]
+* [NoneRXN-9228 RXN-9228]
-* [[RXN-14430]]
+* [NoneRXN-9222 RXN-9222]
-== Reaction(s) known to produce the compound ==
+* [NoneRXN-9223 RXN-9223]
-* [[GLUTCYSLIG-RXN]]
+{{#set: taxonomic-range=tax-2}}
-== Reaction(s) of unknown directionality ==
+{{#set: common-name=ubiquinol-7 biosynthesis (prokaryotic)}}
-{{#set: common-name=&gamma;-l-glutamyl-l-cysteine}}
+{{#set: nb reaction found=3}}
-{{#set: inchi-key=inchikey=ritkhvbhsgluln-whfbiakzsa-m}}
+{{#set: completion rate=0.38}}
-{{#set: molecular-weight=249.261}}
+{{#set: nb total reaction=8}}