Difference between revisions of "PWY-6482"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=INDOLE-3-GLYCEROL-P INDOLE-3-GLYCEROL-P] == * common-name: ** (1s,2r)-1-c-(indol-3-yl)glycerol...")
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7031 CPD-7031] == * common-name: ** 3-methylbutanal * smiles: ** cc(c)c[ch]=o * inchi-key:...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=INDOLE-3-GLYCEROL-P INDOLE-3-GLYCEROL-P] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7031 CPD-7031] ==
 
* common-name:
 
* common-name:
** (1s,2r)-1-c-(indol-3-yl)glycerol 3-phosphate
+
** 3-methylbutanal
 
* smiles:
 
* smiles:
** c2(=c(c1(c=cc=cc=1n2))c(c(cop([o-])(=o)[o-])o)o)
+
** cc(c)c[ch]=o
 
* inchi-key:
 
* inchi-key:
** nqeqtypjsiephw-mnovxskesa-l
+
** yghrjjrrzdovpd-uhfffaoysa-n
 
* molecular-weight:
 
* molecular-weight:
** 285.193
+
** 86.133
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN0-2381]]
+
* [[RXN-7693]]
* [[TRYPSYN-RXN]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[IGPSYN-RXN]]
+
* [[RXN-7693]]
* [[RXN0-2381]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=(1s,2r)-1-c-(indol-3-yl)glycerol 3-phosphate}}
+
{{#set: common-name=3-methylbutanal}}
{{#set: inchi-key=inchikey=nqeqtypjsiephw-mnovxskesa-l}}
+
{{#set: inchi-key=inchikey=yghrjjrrzdovpd-uhfffaoysa-n}}
{{#set: molecular-weight=285.193}}
+
{{#set: molecular-weight=86.133}}

Revision as of 09:22, 27 August 2019

Metabolite CPD-7031

  • common-name:
    • 3-methylbutanal
  • smiles:
    • cc(c)c[ch]=o
  • inchi-key:
    • yghrjjrrzdovpd-uhfffaoysa-n
  • molecular-weight:
    • 86.133

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality