Difference between revisions of "PWY-6510"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=N6N6N6-TRIMETHYL-L-LYSINE N6N6N6-TRIMETHYL-L-LYSINE] == * common-name: ** n6,n6,n6-trimethyl-l-...")
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Enones Enones] == * common-name: ** an enone == Reaction(s) known to consume the compound == *...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=N6N6N6-TRIMETHYL-L-LYSINE N6N6N6-TRIMETHYL-L-LYSINE] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Enones Enones] ==
 
* common-name:
 
* common-name:
** n6,n6,n6-trimethyl-l-lysine
+
** an enone
* smiles:
 
** c[n+](ccccc(c([o-])=o)[n+])(c)c
 
* inchi-key:
 
** mxnrlfusfkvqsk-qmmmgpobsa-o
 
* molecular-weight:
 
** 189.277
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[TRIMETHYLLYSINE-DIOXYGENASE-RXN]]
+
* [[RXN-12267]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[RXN-12267]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=n6,n6,n6-trimethyl-l-lysine}}
+
{{#set: common-name=an enone}}
{{#set: inchi-key=inchikey=mxnrlfusfkvqsk-qmmmgpobsa-o}}
 
{{#set: molecular-weight=189.277}}
 

Revision as of 09:22, 27 August 2019

Metabolite Enones

  • common-name:
    • an enone

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality