Difference between revisions of "PWY-6519"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-9873 CPD-9873] == * common-name: ** 3-demethylubiquinol-10 * smiles: ** cc(c)=cccc(c)=cccc(...")
 
(Created page with "Category:pathway == Pathway PWY-6519 == * taxonomic-range: ** tax-2 * common-name: ** 8-amino-7-oxononanoate biosynthesis i == Reaction(s) found == * RXN-11474 * RXN...")
 
(9 intermediate revisions by 5 users not shown)
Line 1: Line 1:
[[Category:metabolite]]
+
[[Category:pathway]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-9873 CPD-9873] ==
+
== Pathway PWY-6519 ==
 +
* taxonomic-range:
 +
** tax-2
 
* common-name:
 
* common-name:
** 3-demethylubiquinol-10
+
** 8-amino-7-oxononanoate biosynthesis i
* smiles:
+
== Reaction(s) found ==
** cc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=ccc1(=c(o)c(oc)=c(o)c(o)=c(c)1)
+
* [[RXN-11474]]
* inchi-key:
+
* [[RXN-11475]]
** vlmqnhnmqvlpqi-avrcvibksa-n
+
* [[RXN-11476]]
* molecular-weight:
+
* [[RXN-11477]]
** 851.347
+
* [[RXN-11478]]
== Reaction(s) known to consume the compound ==
+
* [[RXN-11479]]
* [[RXN-9237]]
+
* [[RXN-11480]]
== Reaction(s) known to produce the compound ==
+
* [[RXN-11481]]
== Reaction(s) of unknown directionality ==
+
* [[RXN-11482]]
{{#set: common-name=3-demethylubiquinol-10}}
+
== Reaction(s) not found ==
{{#set: inchi-key=inchikey=vlmqnhnmqvlpqi-avrcvibksa-n}}
+
* [NoneRXN-11483 RXN-11483]
{{#set: molecular-weight=851.347}}
+
* [NoneRXN-11484 RXN-11484]
 +
{{#set: taxonomic-range=tax-2}}
 +
{{#set: common-name=8-amino-7-oxononanoate biosynthesis i}}
 +
{{#set: nb reaction found=9}}
 +
{{#set: completion rate=0.82}}
 +
{{#set: nb total reaction=11}}

Latest revision as of 11:00, 18 March 2021

Pathway PWY-6519

  • taxonomic-range:
    • tax-2
  • common-name:
    • 8-amino-7-oxononanoate biosynthesis i

Reaction(s) found

Reaction(s) not found

  • [NoneRXN-11483 RXN-11483]
  • [NoneRXN-11484 RXN-11484]