Difference between revisions of "PWY-6519"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-9873 CPD-9873] == * common-name: ** 3-demethylubiquinol-10 * smiles: ** cc(c)=cccc(c)=cccc(...") |
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=UBIQUINOL-30 UBIQUINOL-30] == * common-name: ** ubiquinol-6 * smiles: ** cc(c)=cccc(c)=cccc(c)=...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=UBIQUINOL-30 UBIQUINOL-30] == |
* common-name: | * common-name: | ||
| − | ** | + | ** ubiquinol-6 |
* smiles: | * smiles: | ||
| − | ** cc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)= | + | ** cc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=ccc1(=c(c)c(=c(oc)c(oc)=c(o)1)o) |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** dyoscpiqeyrqeo-lphqiwjtsa-n |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 592.901 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| + | * [[RXN3O-102]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=ubiquinol-6}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=dyoscpiqeyrqeo-lphqiwjtsa-n}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=592.901}} |
Revision as of 14:19, 26 August 2019
Contents
Metabolite UBIQUINOL-30
- common-name:
- ubiquinol-6
- smiles:
- cc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=ccc1(=c(c)c(=c(oc)c(oc)=c(o)1)o)
- inchi-key:
- dyoscpiqeyrqeo-lphqiwjtsa-n
- molecular-weight:
- 592.901
