Difference between revisions of "PWY-6519"

Revision as of 20:19, 18 December 2020

@@ Line 1: / Line 1: @@
-[[Category:metabolite]]
+[[Category:pathway]]
-== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13171 CPD-13171] ==
+== Pathway PWY-6692 ==
+* taxonomic-range:
+** tax-2
 * common-name:
-** 15,9'-di-cis-phytofluene
+** fe(ii) oxidation
-* smiles:
+== Reaction(s) found ==
-** cc(=cccc(=cccc(=cc=cc(=cc=cc=c(ccc=c(ccc=c(ccc=c(c)c)c)c)c)c)c)c)c
+* [[NADH-DEHYDROG-A-RXN]]
-* inchi-key:
+* [[RXN-15829]]
-** ovsvtcfnlsgamm-iqemyqfosa-n
+* [[RXN-15830]]
-* molecular-weight:
+== Reaction(s) not found ==
-** 542.93
+* [NoneRXN-12076 RXN-12076]
-== Reaction(s) known to consume the compound ==
+* [NoneRXN-12075 RXN-12075]
-* [[RXN-12244]]
+* [NoneCYTOCHROME-C-OXIDASE-RXN CYTOCHROME-C-OXIDASE-RXN]
-== Reaction(s) known to produce the compound ==
+* [NoneRXN-15832 RXN-15832]
-* [[RXN-12243]]
+{{#set: taxonomic-range=tax-2}}
-== Reaction(s) of unknown directionality ==
+{{#set: common-name=fe(ii) oxidation}}
-{{#set: common-name=15,9'-di-cis-phytofluene}}
+{{#set: nb reaction found=3}}
-{{#set: inchi-key=inchikey=ovsvtcfnlsgamm-iqemyqfosa-n}}
+{{#set: completion rate=0.5}}
-{{#set: molecular-weight=542.93}}
+{{#set: nb total reaction=6}}