Difference between revisions of "PWY-6519"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=UBIQUINOL-30 UBIQUINOL-30] == * common-name: ** ubiquinol-6 * smiles: ** cc(c)=cccc(c)=cccc(c)=...") |
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13171 CPD-13171] == * common-name: ** 15,9'-di-cis-phytofluene * smiles: ** cc(=cccc(=cccc(...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13171 CPD-13171] == |
* common-name: | * common-name: | ||
| − | ** | + | ** 15,9'-di-cis-phytofluene |
* smiles: | * smiles: | ||
| − | ** cc( | + | ** cc(=cccc(=cccc(=cc=cc(=cc=cc=c(ccc=c(ccc=c(ccc=c(c)c)c)c)c)c)c)c)c |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** ovsvtcfnlsgamm-iqemyqfosa-n |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 542.93 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| + | * [[RXN-12244]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[RXN-12243]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=15,9'-di-cis-phytofluene}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=ovsvtcfnlsgamm-iqemyqfosa-n}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=542.93}} |
Revision as of 09:23, 27 August 2019
Contents
Metabolite CPD-13171
- common-name:
- 15,9'-di-cis-phytofluene
- smiles:
- cc(=cccc(=cccc(=cc=cc(=cc=cc=c(ccc=c(ccc=c(ccc=c(c)c)c)c)c)c)c)c)c
- inchi-key:
- ovsvtcfnlsgamm-iqemyqfosa-n
- molecular-weight:
- 542.93
