Difference between revisions of "PWY-6520"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=D-GLT D-GLT] == * common-name: ** d-glutamate * smiles: ** c(ccc(c(=o)[o-])[n+])([o-])=o * inch...") |
(Created page with "Category:pathway == Pathway PWY-6520 == * taxonomic-range: ** tax-33090 * common-name: ** nonaprenyl diphosphate biosynthesis ii == Reaction(s) found == * RXN-11486 ==...") |
||
(9 intermediate revisions by 5 users not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:pathway]] |
− | == | + | == Pathway PWY-6520 == |
+ | * taxonomic-range: | ||
+ | ** tax-33090 | ||
* common-name: | * common-name: | ||
− | ** | + | ** nonaprenyl diphosphate biosynthesis ii |
− | + | == Reaction(s) found == | |
− | + | * [[RXN-11486]] | |
− | + | == Reaction(s) not found == | |
− | + | All reactions of this pathways are in present | |
− | + | {{#set: taxonomic-range=tax-33090}} | |
− | + | {{#set: common-name=nonaprenyl diphosphate biosynthesis ii}} | |
− | == Reaction(s) | + | {{#set: nb reaction found=1}} |
− | * [[ | + | {{#set: completion rate=1.0}} |
− | == Reaction(s) | + | {{#set: nb total reaction=1}} |
− | |||
− | |||
− | {{#set: common-name= | ||
− | {{#set: | ||
− | {{#set: |
Latest revision as of 11:00, 18 March 2021
Pathway PWY-6520
- taxonomic-range:
- tax-33090
- common-name:
- nonaprenyl diphosphate biosynthesis ii
Reaction(s) found
Reaction(s) not found
All reactions of this pathways are in present