Difference between revisions of "PWY-6520"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=NICOTINAMIDE_NUCLEOTIDE NICOTINAMIDE_NUCLEOTIDE] == * common-name: ** β-nicotinamide d-rib...")
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Oleoyl-lipid Oleoyl-lipid] == * common-name: ** a [glycerolipid]-oleate == Reaction(s) known to...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=NICOTINAMIDE_NUCLEOTIDE NICOTINAMIDE_NUCLEOTIDE] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Oleoyl-lipid Oleoyl-lipid] ==
 
* common-name:
 
* common-name:
** β-nicotinamide d-ribonucleotide
+
** a [glycerolipid]-oleate
* smiles:
 
** c(op([o-])(=o)[o-])c1(c(o)c(o)c(o1)[n+]2(c=cc=c(c(=o)n)c=2))
 
* inchi-key:
 
** dayljwodmcoqew-turqnecasa-m
 
* molecular-weight:
 
** 333.214
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[2.7.7.1-RXN]]
+
* [[RXN-7421]]
* [[RXN-5841]]
+
* [[RXN-9669]]
 +
* [[RXN-9670]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[DNA-LIGASE-NAD+-RXN]]
+
* [[RXN-9670]]
* [[NADPYROPHOSPHAT-RXN]]
 
* [[RXN-17920]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=β-nicotinamide d-ribonucleotide}}
+
{{#set: common-name=a [glycerolipid]-oleate}}
{{#set: inchi-key=inchikey=dayljwodmcoqew-turqnecasa-m}}
 
{{#set: molecular-weight=333.214}}
 

Revision as of 09:22, 27 August 2019

Metabolite Oleoyl-lipid

  • common-name:
    • a [glycerolipid]-oleate

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Property "Common-name" (as page type) with input value "a [glycerolipid]-oleate" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.