Difference between revisions of "PWY-6523"

Latest revision as of 10:59, 18 March 2021

@@ Line 1: / Line 1: @@
-[[Category:metabolite]]
+[[Category:pathway]]
-== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-2474 CPD0-2474] ==
+== Pathway PWY-6523 ==
+* taxonomic-range:
+** tax-2
 * common-name:
-** (s)-nadphx
+** nitrite-dependent anaerobic methane oxidation
-* smiles:
+== Reaction(s) found ==
-** c5(n(c1(oc(c(c1o)o)cop(op(occ4(c(c(c(n3(c2(=c(c(=nc=n2)n)n=c3)))o4)op([o-])([o-])=o)o))([o-])=o)(=o)[o-]))c(o)ccc(c(=o)n)=5)
+* [[NITRITE-REDUCTASE-CYTOCHROME-RXN]]
-* inchi-key:
+== Reaction(s) not found ==
-** szkxtjuokargiy-vphrtnkssa-j
+* [NoneRXN-11489 RXN-11489]
-* molecular-weight:
+* [NoneMETHANE-MONOOXYGENASE-RXN METHANE-MONOOXYGENASE-RXN]
-** 759.41
+{{#set: taxonomic-range=tax-2}}
-== Reaction(s) known to consume the compound ==
+{{#set: common-name=nitrite-dependent anaerobic methane oxidation}}
-* [[RXN-13139]]
+{{#set: nb reaction found=1}}
-== Reaction(s) known to produce the compound ==
+{{#set: completion rate=0.33}}
-* [[RXN-13139]]
+{{#set: nb total reaction=3}}
-* [[RXN-13142]]
-== Reaction(s) of unknown directionality ==
-{{#set: common-name=(s)-nadphx}}
-{{#set: inchi-key=inchikey=szkxtjuokargiy-vphrtnkssa-j}}
-{{#set: molecular-weight=759.41}}