Difference between revisions of "PWY-6524"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15369 CPD-15369] == * common-name: ** 3r-hydroxy-lesqueroloyl-coa * smiles: ** ccccccc(o)cc...")
 
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Protein-tyrosine-phosphates Protein-tyrosine-phosphates] == * common-name: ** a [protein]-l-tyr...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15369 CPD-15369] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Protein-tyrosine-phosphates Protein-tyrosine-phosphates] ==
 
* common-name:
 
* common-name:
** 3r-hydroxy-lesqueroloyl-coa
+
** a [protein]-l-tyrosine phosphate
* smiles:
 
** ccccccc(o)cc=ccccccccc(o)cc(sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-])=o
 
* inchi-key:
 
** chmqnmkvoyfhhx-sgpqcwjrsa-j
 
* molecular-weight:
 
** 1088.005
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-14494]]
+
* [[PROTEIN-TYROSINE-PHOSPHATASE-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-14493]]
+
* [[2.7.10.1-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=3r-hydroxy-lesqueroloyl-coa}}
+
{{#set: common-name=a [protein]-l-tyrosine phosphate}}
{{#set: inchi-key=inchikey=chmqnmkvoyfhhx-sgpqcwjrsa-j}}
 
{{#set: molecular-weight=1088.005}}
 

Revision as of 14:18, 26 August 2019

Metabolite Protein-tyrosine-phosphates

  • common-name:
    • a [protein]-l-tyrosine phosphate

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Property "Common-name" (as page type) with input value "a [protein]-l-tyrosine phosphate" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.