Difference between revisions of "PWY-6527"

Revision as of 14:19, 26 August 2019

@@ Line 1: / Line 1: @@
 [[Category:metabolite]]
-== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DUTP DUTP] ==
+== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8347 CPD-8347] ==
 * common-name:
-** dutp
+** 1-18:2-2-lysophosphatidylcholine
 * smiles:
-** c(c2(c(cc(n1(c(nc(c=c1)=o)=o))o2)o))op(op(op(=o)([o-])[o-])([o-])=o)([o-])=o
+** cccccc=ccc=ccccccccc(occ(o)cop([o-])(=o)occ[n+](c)(c)c)=o
 * inchi-key:
-** ahcymluzirlxaa-shyzeuofsa-j
+** spjfyyjxnpezdw-ftjopakqsa-n
 * molecular-weight:
-** 464.112
+** 519.657
 == Reaction(s) known to consume the compound ==
-* [[DUTCP]]
-* [[DUTNH]]
-* [[DUTP-PYROP-RXN]]
-* [[DUTUP]]
-* [[RXN-14199]]
-* [[RXN-14219]]
 == Reaction(s) known to produce the compound ==
-* [[ATDUD]]
+* [[RXN-12430]]
-* [[ATDUDm]]
-* [[DUDPKIN-RXN]]
-* [[RXN0-724]]
 == Reaction(s) of unknown directionality ==
-{{#set: common-name=dutp}}
+{{#set: common-name=1-18:2-2-lysophosphatidylcholine}}
-{{#set: inchi-key=inchikey=ahcymluzirlxaa-shyzeuofsa-j}}
+{{#set: inchi-key=inchikey=spjfyyjxnpezdw-ftjopakqsa-n}}
-{{#set: molecular-weight=464.112}}
+{{#set: molecular-weight=519.657}}