Difference between revisions of "PWY-6527"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8347 CPD-8347] == * common-name: ** 1-18:2-2-lysophosphatidylcholine * smiles: ** cccccc=cc...")
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Retinols Retinols] == * common-name: ** a retinol == Reaction(s) known to consume the compound...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8347 CPD-8347] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Retinols Retinols] ==
 
* common-name:
 
* common-name:
** 1-18:2-2-lysophosphatidylcholine
+
** a retinol
* smiles:
 
** cccccc=ccc=ccccccccc(occ(o)cop([o-])(=o)occ[n+](c)(c)c)=o
 
* inchi-key:
 
** spjfyyjxnpezdw-ftjopakqsa-n
 
* molecular-weight:
 
** 519.657
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[RETINOLSAT]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-12430]]
+
* [[RETINYL-PALMITATE-ESTERASE-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=1-18:2-2-lysophosphatidylcholine}}
+
{{#set: common-name=a retinol}}
{{#set: inchi-key=inchikey=spjfyyjxnpezdw-ftjopakqsa-n}}
 
{{#set: molecular-weight=519.657}}
 

Revision as of 09:22, 27 August 2019

Metabolite Retinols

  • common-name:
    • a retinol

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality