Difference between revisions of "PWY-6543"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CARBAMYUL-L-ASPARTATE CARBAMYUL-L-ASPARTATE] == * common-name: ** n-carbamoyl-l-aspartate * smi...")
 
(Created page with "Category:pathway == Pathway PWY-6543 == * taxonomic-range: ** tax-4751 ** tax-2157 ** tax-2 ** tax-33090 * common-name: ** 4-aminobenzoate biosynthesis == Reaction(s) foun...")
 
(9 intermediate revisions by 5 users not shown)
Line 1: Line 1:
[[Category:metabolite]]
+
[[Category:pathway]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CARBAMYUL-L-ASPARTATE CARBAMYUL-L-ASPARTATE] ==
+
== Pathway PWY-6543 ==
 +
* taxonomic-range:
 +
** tax-4751
 +
** tax-2157
 +
** tax-2
 +
** tax-33090
 
* common-name:
 
* common-name:
** n-carbamoyl-l-aspartate
+
** 4-aminobenzoate biosynthesis
* smiles:
+
== Reaction(s) found ==
** c(=o)([o-])cc(nc(n)=o)c([o-])=o
+
* [[ADCLY-RXN]]
* inchi-key:
+
* [[PABASYN-RXN]]
** hlkxyzvtanabhz-reohclbhsa-l
+
== Reaction(s) not found ==
* molecular-weight:
+
All reactions of this pathways are in present
** 174.113
+
{{#set: taxonomic-range=tax-4751|tax-2|tax-2157|tax-33090}}
== Reaction(s) known to consume the compound ==
+
{{#set: common-name=4-aminobenzoate biosynthesis}}
* [[ASPCARBTRANS-RXN]]
+
{{#set: nb reaction found=2}}
* [[DIHYDROOROT-RXN]]
+
{{#set: completion rate=1.0}}
== Reaction(s) known to produce the compound ==
+
{{#set: nb total reaction=2}}
* [[ASPCARBTRANS-RXN]]
 
* [[DIHYDROOROT-RXN]]
 
== Reaction(s) of unknown directionality ==
 
{{#set: common-name=n-carbamoyl-l-aspartate}}
 
{{#set: inchi-key=inchikey=hlkxyzvtanabhz-reohclbhsa-l}}
 
{{#set: molecular-weight=174.113}}
 

Latest revision as of 10:57, 18 March 2021

Pathway PWY-6543

  • taxonomic-range:
    • tax-4751
    • tax-2157
    • tax-2
    • tax-33090
  • common-name:
    • 4-aminobenzoate biosynthesis

Reaction(s) found

Reaction(s) not found

All reactions of this pathways are in present