Difference between revisions of "PWY-6545"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17368 CPD-17368] == * common-name: ** trans-adre-2-enoyl-coa * smiles: ** cccccc=ccc=ccc=cc...")
 
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=MUTATED-TRNA MUTATED-TRNA] == * common-name: ** mutated trna == Reaction(s) known to consume th...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17368 CPD-17368] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=MUTATED-TRNA MUTATED-TRNA] ==
 
* common-name:
 
* common-name:
** trans-adre-2-enoyl-coa
+
** mutated trna
* smiles:
 
** cccccc=ccc=ccc=ccc=ccccc=cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
 
* inchi-key:
 
** xsibquoflnivek-xpbiuritsa-j
 
* molecular-weight:
 
** 1075.997
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[RXN0-6525]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-16113]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=trans-adre-2-enoyl-coa}}
+
{{#set: common-name=mutated trna}}
{{#set: inchi-key=inchikey=xsibquoflnivek-xpbiuritsa-j}}
 
{{#set: molecular-weight=1075.997}}
 

Revision as of 14:18, 26 August 2019

Metabolite MUTATED-TRNA

  • common-name:
    • mutated trna

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality