Difference between revisions of "PWY-6558"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DADP DADP] == * common-name: ** dadp * smiles: ** c(c3(c(cc(n2(c1(=c(c(=nc=n1)n)n=c2)))o3)o))op...")
 
(Created page with "Category:pathway == Pathway PWY-6558 == * taxonomic-range: ** tax-33208 * common-name: ** heparan sulfate biosynthesis (late stages) == Reaction(s) found == * 2.4.1.223-...")
 
(9 intermediate revisions by 4 users not shown)
Line 1: Line 1:
[[Category:metabolite]]
+
[[Category:pathway]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DADP DADP] ==
+
== Pathway PWY-6558 ==
 +
* taxonomic-range:
 +
** tax-33208
 
* common-name:
 
* common-name:
** dadp
+
** heparan sulfate biosynthesis (late stages)
* smiles:
+
== Reaction(s) found ==
** c(c3(c(cc(n2(c1(=c(c(=nc=n1)n)n=c2)))o3)o))op(op([o-])([o-])=o)([o-])=o
+
* [[2.4.1.223-RXN]]
* inchi-key:
+
* [[2.4.1.224-RXN]]
** daeapnuqqaicnr-rrkcrqdmsa-k
+
* [[2.4.1.225-RXN]]
* molecular-weight:
+
* [[2.8.2.23-RXN]]
** 408.18
+
* [[2.8.2.29-RXN]]
== Reaction(s) known to consume the compound ==
+
* [[2.8.2.30-RXN]]
* [[DADPKIN-RXN]]
+
* [[HEPARITIN-SULFOTRANSFERASE-RXN]]
* [[DATPtm]]
+
== Reaction(s) not found ==
* [[NDPK]]
+
* [NoneRXN-16327 RXN-16327]
* [[NDPKm]]
+
* [NoneRXN-11563 RXN-11563]
* [[RXN-14192]]
+
* [NoneRXN-11558 RXN-11558]
* [[RXN-14215]]
+
* [NoneRXN-11562 RXN-11562]
== Reaction(s) known to produce the compound ==
+
* [None5.1.3.17-RXN 5.1.3.17-RXN]
* [[ADPREDUCT-RXN]]
+
* [NoneRXN-11557 RXN-11557]
* [[ATDAM]]
+
{{#set: taxonomic-range=tax-33208}}
* [[DAOTO]]
+
{{#set: common-name=heparan sulfate biosynthesis (late stages)}}
* [[DATCY]]
+
{{#set: nb reaction found=7}}
* [[DATPtm]]
+
{{#set: completion rate=0.54}}
* [[DATUP]]
+
{{#set: nb total reaction=13}}
* [[DEOXYADENYLATE-KINASE-RXN]]
 
* [[RXN-14214]]
 
* [[RXN0-747]]
 
== Reaction(s) of unknown directionality ==
 
{{#set: common-name=dadp}}
 
{{#set: inchi-key=inchikey=daeapnuqqaicnr-rrkcrqdmsa-k}}
 
{{#set: molecular-weight=408.18}}
 

Latest revision as of 10:58, 18 March 2021

Pathway PWY-6558

  • taxonomic-range:
    • tax-33208
  • common-name:
    • heparan sulfate biosynthesis (late stages)

Reaction(s) found

Reaction(s) not found

  • [NoneRXN-16327 RXN-16327]
  • [NoneRXN-11563 RXN-11563]
  • [NoneRXN-11558 RXN-11558]
  • [NoneRXN-11562 RXN-11562]
  • [None5.1.3.17-RXN 5.1.3.17-RXN]
  • [NoneRXN-11557 RXN-11557]