Difference between revisions of "PWY-6559"

Latest revision as of 11:00, 18 March 2021

@@ Line 1: / Line 1: @@
-[[Category:metabolite]]
+[[Category:pathway]]
-== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7280 CPD-7280] ==
+== Pathway PWY-6559 ==
+* taxonomic-range:
+** tax-2
 * common-name:
-** (3s,5r,6s)-5,6-epoxy-3-hydroxy-5,6-dihydro-12'-apo-&beta;-caroten-12'-al
+** spermidine biosynthesis ii
-* smiles:
+== Reaction(s) found ==
-** cc(c=cc=c(c)c=cc12(oc(cc(o)cc(c)(c)1)2))=cc=cc=c(c)cc=o
+* [[ASPARTATE-SEMIALDEHYDE-DEHYDROGENASE-RXN]]
-* inchi-key:
+* [[ASPARTATEKIN-RXN]]
-** fyydcjdefsyvoy-wenurhbksa-n
+== Reaction(s) not found ==
-* molecular-weight:
+* [NoneRXN-11566 RXN-11566]
-** 382.542
+* [NoneRXN-11564 RXN-11564]
-== Reaction(s) known to consume the compound ==
+{{#set: taxonomic-range=tax-2}}
-== Reaction(s) known to produce the compound ==
+{{#set: common-name=spermidine biosynthesis ii}}
-* [[RXN-7973-CPD-7424/OXYGEN-MOLECULE//CPD-7279/CPD-7280.44.]]
+{{#set: nb reaction found=2}}
-== Reaction(s) of unknown directionality ==
+{{#set: completion rate=0.5}}
-{{#set: common-name=(3s,5r,6s)-5,6-epoxy-3-hydroxy-5,6-dihydro-12'-apo-&beta;-caroten-12'-al}}
+{{#set: nb total reaction=4}}
-{{#set: inchi-key=inchikey=fyydcjdefsyvoy-wenurhbksa-n}}
-{{#set: molecular-weight=382.542}}