Difference between revisions of "PWY-6577"

Latest revision as of 10:58, 18 March 2021

@@ Line 1: / Line 1: @@
-[[Category:metabolite]]
+[[Category:pathway]]
-== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12565 CPD-12565] ==
+== Pathway PWY-6577 ==
+* taxonomic-range:
+** tax-33090
 * common-name:
-** n-acetyl-d-galactosamine 6-o-sulfate
+** farnesylcysteine salvage pathway
-* smiles:
+== Reaction(s) found ==
-** cc(=o)nc1(c(o)oc(cos(=o)(=o)[o-])c(o)c(o)1)
+* [[RXN-11623]]
-* inchi-key:
+== Reaction(s) not found ==
-** wjfveeaiyioath-kewyirbnsa-m
+* [NoneRXN-11626 RXN-11626]
-* molecular-weight:
+* [NoneRXN-11625 RXN-11625]
-** 300.26
+* [NoneFARNESOL-DEHYDROGENASE-RXN FARNESOL-DEHYDROGENASE-RXN]
-== Reaction(s) known to consume the compound ==
+{{#set: taxonomic-range=tax-33090}}
-== Reaction(s) known to produce the compound ==
+{{#set: common-name=farnesylcysteine salvage pathway}}
-* [[RXN-12177]]
+{{#set: nb reaction found=1}}
-== Reaction(s) of unknown directionality ==
+{{#set: completion rate=0.25}}
-{{#set: common-name=n-acetyl-d-galactosamine 6-o-sulfate}}
+{{#set: nb total reaction=4}}
-{{#set: inchi-key=inchikey=wjfveeaiyioath-kewyirbnsa-m}}
-{{#set: molecular-weight=300.26}}