Difference between revisions of "PWY-6577"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=AMINO-RIBOSYLAMINO-1H-3H-PYR-DIONE AMINO-RIBOSYLAMINO-1H-3H-PYR-DIONE] == * common-name: ** 5-a...")
(Created page with "Category:pathway == Pathway PWY-6577 == * taxonomic-range: ** tax-33090 * common-name: ** farnesylcysteine salvage pathway == Reaction(s) found == * RXN-11623 == React...")
 
(7 intermediate revisions by 3 users not shown)
Line 1: Line 1:
[[Category:metabolite]]
+
[[Category:pathway]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=AMINO-RIBOSYLAMINO-1H-3H-PYR-DIONE AMINO-RIBOSYLAMINO-1H-3H-PYR-DIONE] ==
+
== Pathway PWY-6577 ==
 +
* taxonomic-range:
 +
** tax-33090
 
* common-name:
 
* common-name:
** 5-amino-6-(d-ribitylamino)uracil
+
** farnesylcysteine salvage pathway
* smiles:
+
== Reaction(s) found ==
** c(nc1(nc(nc(=o)c(n)=1)=o))c(o)c(o)c(o)co
+
* [[RXN-11623]]
* inchi-key:
+
== Reaction(s) not found ==
** xkqzixvjvupore-rpdrrwsusa-n
+
* [NoneRXN-11626 RXN-11626]
* molecular-weight:
+
* [NoneRXN-11625 RXN-11625]
** 276.249
+
* [NoneFARNESOL-DEHYDROGENASE-RXN FARNESOL-DEHYDROGENASE-RXN]
== Reaction(s) known to consume the compound ==
+
{{#set: taxonomic-range=tax-33090}}
* [[LUMAZINESYN-RXN]]
+
{{#set: common-name=farnesylcysteine salvage pathway}}
== Reaction(s) known to produce the compound ==
+
{{#set: nb reaction found=1}}
* [[RIBOFLAVIN-SYN-RXN]]
+
{{#set: completion rate=0.25}}
== Reaction(s) of unknown directionality ==
+
{{#set: nb total reaction=4}}
{{#set: common-name=5-amino-6-(d-ribitylamino)uracil}}
 
{{#set: inchi-key=inchikey=xkqzixvjvupore-rpdrrwsusa-n}}
 
{{#set: molecular-weight=276.249}}
 

Latest revision as of 10:58, 18 March 2021

Pathway PWY-6577

  • taxonomic-range:
    • tax-33090
  • common-name:
    • farnesylcysteine salvage pathway

Reaction(s) found

Reaction(s) not found

  • [NoneRXN-11626 RXN-11626]
  • [NoneRXN-11625 RXN-11625]
  • [NoneFARNESOL-DEHYDROGENASE-RXN FARNESOL-DEHYDROGENASE-RXN]