Difference between revisions of "PWY-6577"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=tRNAs-with-queuine tRNAs-with-queuine] == * common-name: ** a queuosine34 in trna == Reaction(s...") |
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12565 CPD-12565] == * common-name: ** n-acetyl-d-galactosamine 6-o-sulfate * smiles: ** cc(...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12565 CPD-12565] == |
* common-name: | * common-name: | ||
| − | ** | + | ** n-acetyl-d-galactosamine 6-o-sulfate |
| + | * smiles: | ||
| + | ** cc(=o)nc1(c(o)oc(cos(=o)(=o)[o-])c(o)c(o)1) | ||
| + | * inchi-key: | ||
| + | ** wjfveeaiyioath-kewyirbnsa-m | ||
| + | * molecular-weight: | ||
| + | ** 300.26 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[RXN-12177]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=n-acetyl-d-galactosamine 6-o-sulfate}} |
| + | {{#set: inchi-key=inchikey=wjfveeaiyioath-kewyirbnsa-m}} | ||
| + | {{#set: molecular-weight=300.26}} | ||
Revision as of 14:18, 26 August 2019
Contents
Metabolite CPD-12565
- common-name:
- n-acetyl-d-galactosamine 6-o-sulfate
- smiles:
- cc(=o)nc1(c(o)oc(cos(=o)(=o)[o-])c(o)c(o)1)
- inchi-key:
- wjfveeaiyioath-kewyirbnsa-m
- molecular-weight:
- 300.26
