Difference between revisions of "PWY-6580"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=UTP UTP] == * common-name: ** utp * smiles: ** c(op(=o)([o-])op(=o)([o-])op(=o)([o-])[o-])c1(oc...")
 
(Created page with "Category:pathway == Pathway PWY-6580 == * taxonomic-range: ** tax-2 * common-name: ** phosphatidylinositol biosynthesis i (bacteria) == Reaction(s) found == * MYO-INOSIT...")
 
(9 intermediate revisions by 4 users not shown)
Line 1: Line 1:
[[Category:metabolite]]
+
[[Category:pathway]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=UTP UTP] ==
+
== Pathway PWY-6580 ==
 +
* taxonomic-range:
 +
** tax-2
 
* common-name:
 
* common-name:
** utp
+
** phosphatidylinositol biosynthesis i (bacteria)
* smiles:
+
== Reaction(s) found ==
** c(op(=o)([o-])op(=o)([o-])op(=o)([o-])[o-])c1(oc(c(o)c(o)1)n2(c=cc(=o)nc(=o)2))
+
* [[MYO-INOSITOL-1-PHOSPHATE-SYNTHASE-RXN]]
* inchi-key:
+
* [[PHOSPHATIDYLINOSITOL-3-PHOSPHATASE-RXN]]
** pgavkcovuiysfo-xvfcmesisa-j
+
== Reaction(s) not found ==
* molecular-weight:
+
* [NoneRXN-11639 RXN-11639]
** 480.112
+
{{#set: taxonomic-range=tax-2}}
== Reaction(s) known to consume the compound ==
+
{{#set: common-name=phosphatidylinositol biosynthesis i (bacteria)}}
* [[2.7.7.11-RXN]]
+
{{#set: nb reaction found=2}}
* [[2.7.7.44-RXN]]
+
{{#set: completion rate=0.67}}
* [[2.7.7.64-RXN]]
+
{{#set: nb total reaction=3}}
* [[CTPSYN-RXN]]
 
* [[GLUC1PURIDYLTRANS-RXN]]
 
* [[NAG1P-URIDYLTRANS-RXN]]
 
* [[R00157]]
 
* [[RNA-URIDYLYLTRANSFERASE-RXN]]
 
* [[RXN-12196]]
 
* [[RXN-12199]]
 
* [[RXN-13760]]
 
* [[RXN-14139]]
 
* [[RXN-14325]]
 
* [[RXN0-724]]
 
* [[UG1PUT]]
 
* [[UTCY]]
 
* [[UTPHEXPURIDYLYLTRANS-RXN]]
 
* [[UTPPH]]
 
* [[UTUP]]
 
== Reaction(s) known to produce the compound ==
 
* [[2.7.7.11-RXN]]
 
* [[2.7.7.44-RXN]]
 
* [[2.7.7.64-RXN]]
 
* [[ATUD]]
 
* [[ATUDm]]
 
* [[GLUC1PURIDYLTRANS-RXN]]
 
* [[R00157]]
 
* [[RNA-URIDYLYLTRANSFERASE-RXN]]
 
* [[RXN-13760]]
 
* [[UDPKIN-RXN]]
 
* [[UTPHEXPURIDYLYLTRANS-RXN]]
 
== Reaction(s) of unknown directionality ==
 
{{#set: common-name=utp}}
 
{{#set: inchi-key=inchikey=pgavkcovuiysfo-xvfcmesisa-j}}
 
{{#set: molecular-weight=480.112}}
 

Latest revision as of 10:59, 18 March 2021

Pathway PWY-6580

  • taxonomic-range:
    • tax-2
  • common-name:
    • phosphatidylinositol biosynthesis i (bacteria)

Reaction(s) found

Reaction(s) not found

  • [NoneRXN-11639 RXN-11639]