Difference between revisions of "PWY-6580"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=UTP UTP] == * common-name: ** utp * smiles: ** c(op(=o)([o-])op(=o)([o-])op(=o)([o-])[o-])c1(oc...") |
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15653 CPD-15653] == * common-name: ** (3r)-hydroxy, 6-cis-tridecenoyl-coa * smiles: ** cccc...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15653 CPD-15653] == |
* common-name: | * common-name: | ||
| − | ** | + | ** (3r)-hydroxy, 6-cis-tridecenoyl-coa |
* smiles: | * smiles: | ||
| − | ** | + | ** ccccccc=cccc(o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-] |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** adzjvtnixnsngu-ukoyhulusa-j |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 973.818 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[RXN-14772]] |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=(3r)-hydroxy, 6-cis-tridecenoyl-coa}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=adzjvtnixnsngu-ukoyhulusa-j}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=973.818}} |
Revision as of 14:19, 26 August 2019
Contents
Metabolite CPD-15653
- common-name:
- (3r)-hydroxy, 6-cis-tridecenoyl-coa
- smiles:
- ccccccc=cccc(o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
- inchi-key:
- adzjvtnixnsngu-ukoyhulusa-j
- molecular-weight:
- 973.818
