Difference between revisions of "PWY-6587"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Pyruvate-dehydrogenase-L-serine Pyruvate-dehydrogenase-L-serine] == * common-name: ** a [pyruva...") |
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-332 CPD-332] == * common-name: ** dihydrozeatin * smiles: ** cc(co)ccnc2(=nc=nc1(=c(n=cn1)2...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-332 CPD-332] == |
* common-name: | * common-name: | ||
| − | ** | + | ** dihydrozeatin |
| + | * smiles: | ||
| + | ** cc(co)ccnc2(=nc=nc1(=c(n=cn1)2)) | ||
| + | * inchi-key: | ||
| + | ** xxfactaygkkoqb-zetcqymhsa-n | ||
| + | * molecular-weight: | ||
| + | ** 221.261 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[RXN-4726]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=dihydrozeatin}} |
| + | {{#set: inchi-key=inchikey=xxfactaygkkoqb-zetcqymhsa-n}} | ||
| + | {{#set: molecular-weight=221.261}} | ||
Revision as of 14:19, 26 August 2019
Contents
Metabolite CPD-332
- common-name:
- dihydrozeatin
- smiles:
- cc(co)ccnc2(=nc=nc1(=c(n=cn1)2))
- inchi-key:
- xxfactaygkkoqb-zetcqymhsa-n
- molecular-weight:
- 221.261
