Difference between revisions of "PWY-6596"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ARG ARG] == * common-name: ** l-arginine * smiles: ** c(nc(n)=[n+])ccc([n+])c(=o)[o-] * inchi-k...") |
(Created page with "Category:pathway == Pathway PWY-6596 == * taxonomic-range: ** tax-3193 * common-name: ** adenosine nucleotides degradation i == Reaction(s) found == * [[AMP-DEAMINASE-RXN]...") |
||
| (9 intermediate revisions by 4 users not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:pathway]] |
| − | == | + | == Pathway PWY-6596 == |
| + | * taxonomic-range: | ||
| + | ** tax-3193 | ||
* common-name: | * common-name: | ||
| − | ** | + | ** adenosine nucleotides degradation i |
| − | + | == Reaction(s) found == | |
| − | + | * [[AMP-DEAMINASE-RXN]] | |
| − | + | * [[IMP-DEHYDROG-RXN]] | |
| − | + | * [[RXN-7607]] | |
| − | + | * [[RXN-7682]] | |
| − | + | * [[RXN0-363]] | |
| − | == Reaction(s) | + | * [[RXN0-901]] |
| − | * [[ | + | * [[XMPXAN-RXN]] |
| − | + | == Reaction(s) not found == | |
| − | * [[ | + | * [NoneINOSINE-NUCLEOSIDASE-RXN INOSINE-NUCLEOSIDASE-RXN] |
| − | * [[ | + | {{#set: taxonomic-range=tax-3193}} |
| − | * [[ | + | {{#set: common-name=adenosine nucleotides degradation i}} |
| − | * [[ | + | {{#set: nb reaction found=7}} |
| − | * [[ | + | {{#set: completion rate=0.88}} |
| − | * [[ | + | {{#set: nb total reaction=8}} |
| − | |||
| − | |||
| − | == Reaction(s) | ||
| − | * [ | ||
| − | |||
| − | |||
| − | |||
| − | |||
| − | {{#set: common-name= | ||
| − | {{#set: | ||
| − | {{#set: | ||
Latest revision as of 10:58, 18 March 2021
Pathway PWY-6596
- taxonomic-range:
- tax-3193
- common-name:
- adenosine nucleotides degradation i
Reaction(s) found
Reaction(s) not found
- [NoneINOSINE-NUCLEOSIDASE-RXN INOSINE-NUCLEOSIDASE-RXN]
