Difference between revisions of "PWY-6596"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ARG ARG] == * common-name: ** l-arginine * smiles: ** c(nc(n)=[n+])ccc([n+])c(=o)[o-] * inchi-k...")
 
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=METHIONYL-PEPTIDE METHIONYL-PEPTIDE] == * common-name: ** an n-terminal l-methionyl-[protein] =...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ARG ARG] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=METHIONYL-PEPTIDE METHIONYL-PEPTIDE] ==
 
* common-name:
 
* common-name:
** l-arginine
+
** an n-terminal l-methionyl-[protein]
* smiles:
 
** c(nc(n)=[n+])ccc([n+])c(=o)[o-]
 
* inchi-key:
 
** odksfydxxfifqn-bypyzucnsa-o
 
* molecular-weight:
 
** 175.21
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[1.5.1.11-RXN]]
 
* [[1.5.1.19-RXN]]
 
* [[ARG-OXIDATION-RXN]]
 
* [[ARGDECARBOX-RXN]]
 
* [[ARGINASE-RXN]]
 
* [[ARGININE--TRNA-LIGASE-RXN]]
 
* [[ARGSUCCINLYA-RXN]]
 
* [[NITRIC-OXIDE-SYNTHASE-RXN]]
 
* [[RXN-13564]]
 
* [[biomass_rxn]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[ARGDECARBOX-RXN]]
+
* [[3.5.1.88-RXN]]
* [[ARGINASE-RXN]]
 
* [[ARGSUCCINLYA-RXN]]
 
* [[D-OCTOPINE-DEHYDROGENASE-RXN]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=l-arginine}}
+
{{#set: common-name=an n-terminal l-methionyl-[protein]}}
{{#set: inchi-key=inchikey=odksfydxxfifqn-bypyzucnsa-o}}
 
{{#set: molecular-weight=175.21}}
 

Revision as of 14:18, 26 August 2019

Metabolite METHIONYL-PEPTIDE

  • common-name:
    • an n-terminal l-methionyl-[protein]

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Property "Common-name" (as page type) with input value "an n-terminal l-methionyl-[protein" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.