Difference between revisions of "PWY-6603"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ALA-GLY ALA-GLY] == * common-name: ** l-alanyl-glycine * smiles: ** cc([n+])c(ncc([o-])=o)=o *...")
 
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CROTONYL-COA CROTONYL-COA] == * common-name: ** crotonyl-coa * smiles: ** cc=cc(sccnc(ccnc(c(c(...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ALA-GLY ALA-GLY] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CROTONYL-COA CROTONYL-COA] ==
 
* common-name:
 
* common-name:
** l-alanyl-glycine
+
** crotonyl-coa
 
* smiles:
 
* smiles:
** cc([n+])c(ncc([o-])=o)=o
+
** cc=cc(sccnc(ccnc(c(c(cop(=o)([o-])op(occ1(oc(c(c1op([o-])([o-])=o)o)n3(c=nc2(c(=nc=nc=23)n))))([o-])=o)(c)c)o)=o)=o)=o
 
* inchi-key:
 
* inchi-key:
** cxispyvymqwfle-vkhmyheasa-n
+
** kfwwcmjsysspsk-bogfjhsmsa-j
 
* molecular-weight:
 
* molecular-weight:
** 146.146
+
** 831.577
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN0-6977]]
+
* [[ACOAD1f]]
 +
* [[ACOAR1h]]
 +
* [[BUTYRYL-COA-DEHYDROGENASE-RXN]]
 +
* [[GLUTACONYL-COA-DECARBOXYLASE-RXN]]
 +
* [[GLUTARYL-COA-DEHYDROGENASE-RXN]]
 +
* [[HBCHL]]
 +
* [[HBCHLm]]
 +
* [[RXN-11667]]
 +
* [[RXN-12558]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[ACOA40OR]]
 +
* [[ACOAD1f]]
 +
* [[GLUTACONYL-COA-DECARBOXYLASE-RXN]]
 +
* [[GLUTARYL-COA-DEHYDROGENASE-RXN]]
 +
* [[HBCHL]]
 +
* [[HBCHLm]]
 +
* [[RXN-11667]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=l-alanyl-glycine}}
+
{{#set: common-name=crotonyl-coa}}
{{#set: inchi-key=inchikey=cxispyvymqwfle-vkhmyheasa-n}}
+
{{#set: inchi-key=inchikey=kfwwcmjsysspsk-bogfjhsmsa-j}}
{{#set: molecular-weight=146.146}}
+
{{#set: molecular-weight=831.577}}

Revision as of 14:19, 26 August 2019

Metabolite CROTONYL-COA

  • common-name:
    • crotonyl-coa
  • smiles:
    • cc=cc(sccnc(ccnc(c(c(cop(=o)([o-])op(occ1(oc(c(c1op([o-])([o-])=o)o)n3(c=nc2(c(=nc=nc=23)n))))([o-])=o)(c)c)o)=o)=o)=o
  • inchi-key:
    • kfwwcmjsysspsk-bogfjhsmsa-j
  • molecular-weight:
    • 831.577

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality