Difference between revisions of "PWY-6603"

Revision as of 09:22, 27 August 2019

@@ Line 1: / Line 1: @@
 [[Category:metabolite]]
-== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CROTONYL-COA CROTONYL-COA] ==
+== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=PHENYLACETALDEHYDE PHENYLACETALDEHYDE] ==
 * common-name:
-** crotonyl-coa
+** phenylacetaldehyde
 * smiles:
-** cc=cc(sccnc(ccnc(c(c(cop(=o)([o-])op(occ1(oc(c(c1op([o-])([o-])=o)o)n3(c=nc2(c(=nc=nc=23)n))))([o-])=o)(c)c)o)=o)=o)=o
+** [ch](=o)cc1(=cc=cc=c1)
 * inchi-key:
-** kfwwcmjsysspsk-bogfjhsmsa-j
+** dtuqwgwmvihbke-uhfffaoysa-n
 * molecular-weight:
-** 831.577
+** 120.151
 == Reaction(s) known to consume the compound ==
-* [[ACOAD1f]]
+* [[RXN-7700]]
-* [[ACOAR1h]]
-* [[BUTYRYL-COA-DEHYDROGENASE-RXN]]
-* [[GLUTACONYL-COA-DECARBOXYLASE-RXN]]
-* [[GLUTARYL-COA-DEHYDROGENASE-RXN]]
-* [[HBCHL]]
-* [[HBCHLm]]
-* [[RXN-11667]]
-* [[RXN-12558]]
 == Reaction(s) known to produce the compound ==
-* [[ACOA40OR]]
+* [[RXN-10817]]
-* [[ACOAD1f]]
-* [[GLUTACONYL-COA-DECARBOXYLASE-RXN]]
-* [[GLUTARYL-COA-DEHYDROGENASE-RXN]]
-* [[HBCHL]]
-* [[HBCHLm]]
-* [[RXN-11667]]
 == Reaction(s) of unknown directionality ==
-{{#set: common-name=crotonyl-coa}}
+{{#set: common-name=phenylacetaldehyde}}
-{{#set: inchi-key=inchikey=kfwwcmjsysspsk-bogfjhsmsa-j}}
+{{#set: inchi-key=inchikey=dtuqwgwmvihbke-uhfffaoysa-n}}
-{{#set: molecular-weight=831.577}}
+{{#set: molecular-weight=120.151}}