Difference between revisions of "PWY-6605"

Latest revision as of 10:58, 18 March 2021

@@ Line 1: / Line 1: @@
-[[Category:metabolite]]
+[[Category:pathway]]
-== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=GLUTARYL-COA GLUTARYL-COA] ==
+== Pathway PWY-6605 ==
+* taxonomic-range:
+** tax-2759
+** tax-2
 * common-name:
-** glutaryl-coa
+** adenine and adenosine salvage ii
-* smiles:
+== Reaction(s) found ==
-** cc(c)(c(o)c(=o)nccc(=o)nccsc(cccc(=o)[o-])=o)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
+* [[ADENPRIBOSYLTRAN-RXN]]
-* inchi-key:
+== Reaction(s) not found ==
-** sykwlijqehrdnh-ckrmaksasa-i
+* [NoneADENOSINE-NUCLEOSIDASE-RXN ADENOSINE-NUCLEOSIDASE-RXN]
-* molecular-weight:
+{{#set: taxonomic-range=tax-2|tax-2759}}
-** 876.595
+{{#set: common-name=adenine and adenosine salvage ii}}
-== Reaction(s) known to consume the compound ==
+{{#set: nb reaction found=1}}
-* [[GLUTARYL-COA-DEHYDROG-RXN]]
+{{#set: completion rate=0.5}}
-* [[GLUTARYL-COA-DEHYDROGENASE-RXN]]
+{{#set: nb total reaction=2}}
-* [[RXN-8032]]
-== Reaction(s) known to produce the compound ==
-* [[2-KETO-ADIPATE-DEHYDROG-RXN]]
-* [[GLUTARYL-COA-DEHYDROG-RXN]]
-* [[GLUTARYL-COA-DEHYDROGENASE-RXN]]
-* [[RXN-8032]]
-== Reaction(s) of unknown directionality ==
-{{#set: common-name=glutaryl-coa}}
-{{#set: inchi-key=inchikey=sykwlijqehrdnh-ckrmaksasa-i}}
-{{#set: molecular-weight=876.595}}