Difference between revisions of "PWY-6605"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=GMP GMP] == * common-name: ** gmp * smiles: ** c(op(=o)([o-])[o-])c1(oc(c(o)c(o)1)n3(c=nc2(c(=o...") |
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=GLUTARYL-COA GLUTARYL-COA] == * common-name: ** glutaryl-coa * smiles: ** cc(c)(c(o)c(=o)nccc(=...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=GLUTARYL-COA GLUTARYL-COA] == |
* common-name: | * common-name: | ||
| − | ** | + | ** glutaryl-coa |
* smiles: | * smiles: | ||
| − | ** c(op(=o)([o-])[o-]) | + | ** cc(c)(c(o)c(=o)nccc(=o)nccsc(cccc(=o)[o-])=o)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-] |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** sykwlijqehrdnh-ckrmaksasa-i |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 876.595 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[GLUTARYL-COA-DEHYDROG-RXN]] |
| − | + | * [[GLUTARYL-COA-DEHYDROGENASE-RXN]] | |
| − | * [[ | + | * [[RXN-8032]] |
| − | |||
| − | * [[RXN- | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[2-KETO-ADIPATE-DEHYDROG-RXN]] |
| − | + | * [[GLUTARYL-COA-DEHYDROG-RXN]] | |
| − | + | * [[GLUTARYL-COA-DEHYDROGENASE-RXN]] | |
| − | * [[ | + | * [[RXN-8032]] |
| − | * [[ | ||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | * [[RXN- | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=glutaryl-coa}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=sykwlijqehrdnh-ckrmaksasa-i}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=876.595}} |
Revision as of 14:18, 26 August 2019
Contents
Metabolite GLUTARYL-COA
- common-name:
- glutaryl-coa
- smiles:
- cc(c)(c(o)c(=o)nccc(=o)nccsc(cccc(=o)[o-])=o)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
- inchi-key:
- sykwlijqehrdnh-ckrmaksasa-i
- molecular-weight:
- 876.595
