Difference between revisions of "PWY-6608"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DGMP DGMP] == * common-name: ** dgmp * smiles: ** c(op(=o)([o-])[o-])c1(oc(cc(o)1)n3(c=nc2(c(=o...")
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11408 CPD-11408] == * common-name: ** triiodothyronine sulfate * smiles: ** c2(c=c(os(=o)(=...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DGMP DGMP] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11408 CPD-11408] ==
 
* common-name:
 
* common-name:
** dgmp
+
** triiodothyronine sulfate
 
* smiles:
 
* smiles:
** c(op(=o)([o-])[o-])c1(oc(cc(o)1)n3(c=nc2(c(=o)nc(n)=nc=23)))
+
** c2(c=c(os(=o)(=o)[o-])c(=cc(oc1(c(=cc(=cc(i)=1)cc(c(=o)[o-])[n+])i))=2)i)
 
* inchi-key:
 
* inchi-key:
** ltfmzdnnppeqng-kvqbguixsa-l
+
** xbqyqxvjbndcgy-lbprgkrzsa-m
 
* molecular-weight:
 
* molecular-weight:
** 345.208
+
** 730.028
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[ATDGM]]
 
* [[DMPH]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[DGTD]]
+
* [[RXN-10615]]
* [[DMPH]]
 
* [[RXN-14208]]
 
* [[RXN-14218]]
 
* [[RXN0-385]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=dgmp}}
+
{{#set: common-name=triiodothyronine sulfate}}
{{#set: inchi-key=inchikey=ltfmzdnnppeqng-kvqbguixsa-l}}
+
{{#set: inchi-key=inchikey=xbqyqxvjbndcgy-lbprgkrzsa-m}}
{{#set: molecular-weight=345.208}}
+
{{#set: molecular-weight=730.028}}

Revision as of 09:22, 27 August 2019

Metabolite CPD-11408

  • common-name:
    • triiodothyronine sulfate
  • smiles:
    • c2(c=c(os(=o)(=o)[o-])c(=cc(oc1(c(=cc(=cc(i)=1)cc(c(=o)[o-])[n+])i))=2)i)
  • inchi-key:
    • xbqyqxvjbndcgy-lbprgkrzsa-m
  • molecular-weight:
    • 730.028

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality