Difference between revisions of "PWY-6610"

Revision as of 20:15, 18 December 2020

@@ Line 1: / Line 1: @@
-[[Category:metabolite]]
+[[Category:pathway]]
-== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=GAMA-TOCOPHEROL GAMA-TOCOPHEROL] ==
+== Pathway PWY3O-4106 ==
+* taxonomic-range:
+** tax-33208
+** tax-4751
+** tax-2
 * common-name:
-** &gamma;-tocopherol
+** nad salvage pathway iv
-* smiles:
+== Reaction(s) found ==
-** cc(c)cccc(c)cccc(c)cccc1(c)(ccc2(=cc(o)=c(c)c(=c(o1)2)c))
+* [[2.7.7.1-RXN]]
-* inchi-key:
+== Reaction(s) not found ==
-** quedxnhftdjviy-dqczwyhmsa-n
+* [NoneRIBOSYLNICOTINAMIDE-KINASE-RXN RIBOSYLNICOTINAMIDE-KINASE-RXN]
-* molecular-weight:
+{{#set: taxonomic-range=tax-2|tax-4751|tax-33208}}
-** 416.686
+{{#set: common-name=nad salvage pathway iv}}
-== Reaction(s) known to consume the compound ==
+{{#set: nb reaction found=1}}
-* [[TOCOPHEROL-O-METHYLTRANSFERASE-RXN]]
+{{#set: completion rate=0.5}}
-== Reaction(s) known to produce the compound ==
+{{#set: nb total reaction=2}}
-== Reaction(s) of unknown directionality ==
-{{#set: common-name=&gamma;-tocopherol}}
-{{#set: inchi-key=inchikey=quedxnhftdjviy-dqczwyhmsa-n}}
-{{#set: molecular-weight=416.686}}