Difference between revisions of "PWY-6610"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=GAMA-TOCOPHEROL GAMA-TOCOPHEROL] == * common-name: ** γ-tocopherol * smiles: ** cc(c)cccc...")
(Created page with "Category:pathway == Pathway PWY-6610 == * taxonomic-range: ** tax-33682 ** tax-4751 ** tax-2157 ** tax-2 * common-name: ** adenine salvage == Reaction(s) found == * ADEN...")
 
(7 intermediate revisions by 3 users not shown)
Line 1: Line 1:
[[Category:metabolite]]
+
[[Category:pathway]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=GAMA-TOCOPHEROL GAMA-TOCOPHEROL] ==
+
== Pathway PWY-6610 ==
 +
* taxonomic-range:
 +
** tax-33682
 +
** tax-4751
 +
** tax-2157
 +
** tax-2
 
* common-name:
 
* common-name:
** γ-tocopherol
+
** adenine salvage
* smiles:
+
== Reaction(s) found ==
** cc(c)cccc(c)cccc(c)cccc1(c)(ccc2(=cc(o)=c(c)c(=c(o1)2)c))
+
* [[ADENPRIBOSYLTRAN-RXN]]
* inchi-key:
+
* [[HYPOXANPRIBOSYLTRAN-RXN]]
** quedxnhftdjviy-dqczwyhmsa-n
+
== Reaction(s) not found ==
* molecular-weight:
+
* [NoneADENINE-DEAMINASE-RXN ADENINE-DEAMINASE-RXN]
** 416.686
+
{{#set: taxonomic-range=tax-4751|tax-33682|tax-2|tax-2157}}
== Reaction(s) known to consume the compound ==
+
{{#set: common-name=adenine salvage}}
* [[TOCOPHEROL-O-METHYLTRANSFERASE-RXN]]
+
{{#set: nb reaction found=2}}
== Reaction(s) known to produce the compound ==
+
{{#set: completion rate=0.67}}
== Reaction(s) of unknown directionality ==
+
{{#set: nb total reaction=3}}
{{#set: common-name=γ-tocopherol}}
 
{{#set: inchi-key=inchikey=quedxnhftdjviy-dqczwyhmsa-n}}
 
{{#set: molecular-weight=416.686}}
 

Latest revision as of 10:57, 18 March 2021

Pathway PWY-6610

  • taxonomic-range:
    • tax-33682
    • tax-4751
    • tax-2157
    • tax-2
  • common-name:
    • adenine salvage

Reaction(s) found

Reaction(s) not found

  • [NoneADENINE-DEAMINASE-RXN ADENINE-DEAMINASE-RXN]